C14H9NO3 — CID 66889339
4-acetylbenzo[de]isoquinoline-1,3-dione (PubChem CID 66889339) has the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-acetylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 4-acetylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 66889339 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 4-acetylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CC(=O)c1ccc2cccc3c2c1C(=O)NC3=O |
| InChI | InChI=1S/C14H9NO3/c1-7(16)9-6-5-8-3-2-4-10-11(8)12(9)14(18)15-13(10)17/h2-6H,1H3,(H,15,17,18) |
| InChIKey | FYDYALZEDYEXNV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|