C24H12N2O4 — CID 54485073
2-(1,3-dioxobenzo[de]isoquinolin-4-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 54485073) has the molecular formula C24H12N2O4 and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-(1,3-dioxobenzo[de]isoquinolin-4-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(1,3-dioxobenzo[de]isoquinolin-4-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 54485073 |
| Molecular Formula | C24H12N2O4 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-(1,3-dioxobenzo[de]isoquinolin-4-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1NC(=O)c2c(N3C(=O)c4cccc5cccc(c45)C3=O)ccc3cccc1c23 |
| InChI | InChI=1S/C24H12N2O4/c27-21-14-7-1-6-13-10-11-17(20(19(13)14)22(28)25-21)26-23(29)15-8-2-4-12-5-3-9-16(18(12)15)24(26)30/h1-11H,(H,25,27,28) |
| InChIKey | MKUSOGKPJIQVHM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|