C23H21NO2 — CID 132965970
2-(2,3,4,5,6-pentamethylphenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 132965970) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentamethylphenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2,3,4,5,6-pentamethylphenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 132965970 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-(2,3,4,5,6-pentamethylphenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1c(C)c(C)c(N2C(=O)c3cccc4cccc(c34)C2=O)c(C)c1C |
| InChI | InChI=1S/C23H21NO2/c1-12-13(2)15(4)21(16(5)14(12)3)24-22(25)18-10-6-8-17-9-7-11-19(20(17)18)23(24)26/h6-11H,1-5H3 |
| InChIKey | UDGNMSCQODRGDR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|