C18H12N2O2S — CID 123241495
2-(4-aminosulfanylphenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 123241495) has the molecular formula C18H12N2O2S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-(4-aminosulfanylphenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(4-aminosulfanylphenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 123241495 |
| Molecular Formula | C18H12N2O2S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-(4-aminosulfanylphenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | NSc1ccc(N2C(=O)c3cccc4cccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C18H12N2O2S/c19-23-13-9-7-12(8-10-13)20-17(21)14-5-1-3-11-4-2-6-15(16(11)14)18(20)22/h1-10H,19H2 |
| InChIKey | FRXAPYXAZJTWNF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|