C19H11NO3 — CID 59970412
2-(3-deuteriocarbonylphenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 59970412) has the molecular formula C19H11NO3 and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-(3-deuteriocarbonylphenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(3-deuteriocarbonylphenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 59970412 |
| Molecular Formula | C19H11NO3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-(3-deuteriocarbonylphenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | [2H]C(=O)c1cccc(N2C(=O)c3cccc4cccc(c34)C2=O)c1 |
| InChI | InChI=1S/C19H11NO3/c21-11-12-4-1-7-14(10-12)20-18(22)15-8-2-5-13-6-3-9-16(17(13)15)19(20)23/h1-11H/i11D |
| InChIKey | CFIYJKGPJVAZBS-WORMITQPSA-N |
| XLogP | 3.45 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|