C24H13NO3 — CID 2876619
2-dibenzofuran-3-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 2876619) has the molecular formula C24H13NO3 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-dibenzofuran-3-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-dibenzofuran-3-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2876619 |
| Molecular Formula | C24H13NO3 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-dibenzofuran-3-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C24H13NO3/c26-23-18-8-3-5-14-6-4-9-19(22(14)18)24(27)25(23)15-11-12-17-16-7-1-2-10-20(16)28-21(17)13-15/h1-13H |
| InChIKey | PPCXFPXBZCJVAV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|