C20H10BrNO3 — CID 7550711
5-bromo-2-dibenzofuran-3-ylisoindole-1,3-dione (PubChem CID 7550711) has the molecular formula C20H10BrNO3 and a molecular weight of 392.21 g/mol. Its IUPAC name is 5-bromo-2-dibenzofuran-3-ylisoindole-1,3-dione.
| Compound Name | 5-bromo-2-dibenzofuran-3-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 7550711 |
| Molecular Formula | C20H10BrNO3 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 5-bromo-2-dibenzofuran-3-ylisoindole-1,3-dione |
| SMILES | O=C1c2ccc(Br)cc2C(=O)N1c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C20H10BrNO3/c21-11-5-7-15-16(9-11)20(24)22(19(15)23)12-6-8-14-13-3-1-2-4-17(13)25-18(14)10-12/h1-10H |
| InChIKey | RFGLVCJVNNQCJE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|