C14H7BrFNO3 — CID 64782042
5-bromo-2-(3-fluoro-4-hydroxyphenyl)isoindole-1,3-dione (PubChem CID 64782042) has the molecular formula C14H7BrFNO3 and a molecular weight of 336.12 g/mol. Its IUPAC name is 5-bromo-2-(3-fluoro-4-hydroxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-bromo-2-(3-fluoro-4-hydroxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 64782042 |
| Molecular Formula | C14H7BrFNO3 |
| Molecular Weight | 336.12 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 5-bromo-2-(3-fluoro-4-hydroxyphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Br)cc2C(=O)N1c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C14H7BrFNO3/c15-7-1-3-9-10(5-7)14(20)17(13(9)19)8-2-4-12(18)11(16)6-8/h1-6,18H |
| InChIKey | UNAYVTYCAGEBFV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.12 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|