C13H7FN2O3 — CID 64782032
6-(3-fluoro-4-hydroxyphenyl)pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 64782032) has the molecular formula C13H7FN2O3 and a molecular weight of 258.21 g/mol. Its IUPAC name is 6-(3-fluoro-4-hydroxyphenyl)pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(3-fluoro-4-hydroxyphenyl)pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 64782032 |
| Molecular Formula | C13H7FN2O3 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 6-(3-fluoro-4-hydroxyphenyl)pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C13H7FN2O3/c14-9-6-7(3-4-10(9)17)16-12(18)8-2-1-5-15-11(8)13(16)19/h1-6,17H |
| InChIKey | XDDHMYSLLNQPQV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|