C27H16N4O4 — CID 1306086
6-[4-[[4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]methyl]phenyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 1306086) has the molecular formula C27H16N4O4 and a molecular weight of 460.45 g/mol. Its IUPAC name is 6-[4-[[4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]methyl]phenyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[4-[[4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]methyl]phenyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 1306086 |
| Molecular Formula | C27H16N4O4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 6-[4-[[4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]methyl]phenyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1c1ccc(Cc2ccc(N3C(=O)c4cccnc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H16N4O4/c32-24-20-3-1-13-28-22(20)26(34)30(24)18-9-5-16(6-10-18)15-17-7-11-19(12-8-17)31-25(33)21-4-2-14-29-23(21)27(31)35/h1-14H,15H2 |
| InChIKey | KOCAGHHMBBTUKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|