C16H11N3O2 — CID 60999082
6-[3-(3-aminoprop-1-ynyl)phenyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 60999082) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 6-[3-(3-aminoprop-1-ynyl)phenyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[3-(3-aminoprop-1-ynyl)phenyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 60999082 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 6-[3-(3-aminoprop-1-ynyl)phenyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | NCC#Cc1cccc(N2C(=O)c3cccnc3C2=O)c1 |
| InChI | InChI=1S/C16H11N3O2/c17-8-2-5-11-4-1-6-12(10-11)19-15(20)13-7-3-9-18-14(13)16(19)21/h1,3-4,6-7,9-10H,8,17H2 |
| InChIKey | DUJNMXIPRVYSEU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|