C58H34N2O4 — CID 72565697
2-[4-[6-[2-[6-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl]naphthalen-2-yl]ethenyl]naphthalen-2-yl]phenyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 72565697) has the molecular formula C58H34N2O4 and a molecular weight of 822.92 g/mol. Its IUPAC name is 2-[4-[6-[2-[6-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl]naphthalen-2-yl]ethenyl]naphthalen-2-yl]phenyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[4-[6-[2-[6-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl]naphthalen-2-yl]ethenyl]naphthalen-2-yl]phenyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 72565697 |
| Molecular Formula | C58H34N2O4 |
| Molecular Weight | 822.92 g/mol |
| Exact Mass | 822.25 |
| IUPAC Name | 2-[4-[6-[2-[6-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl]naphthalen-2-yl]ethenyl]naphthalen-2-yl]phenyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1c1ccc(-c2ccc3cc(C=Cc4ccc5cc(-c6ccc(N7C(=O)c8cccc9cccc(c89)C7=O)cc6)ccc5c4)ccc3c2)cc1 |
| InChI | InChI=1S/C58H34N2O4/c61-55-49-9-1-5-39-6-2-10-50(53(39)49)56(62)59(55)47-27-23-37(24-28-47)43-21-19-41-31-35(15-17-45(41)33-43)13-14-36-16-18-46-34-44(22-20-42(46)32-36)38-25-29-48(30-26-38)60-57(63)51-11-3-7-40-8-4-12-52(54(40)51)58(60)64/h1-34H |
| InChIKey | KFJYSQGLSOZSEF-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.92 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|