C22H12N2O4 — CID 632686
2-[4-(1,3-dioxoisoindol-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 632686) has the molecular formula C22H12N2O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 632686 |
| Molecular Formula | C22H12N2O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H12N2O4/c25-19-15-5-1-2-6-16(15)20(26)23(19)13-9-11-14(12-10-13)24-21(27)17-7-3-4-8-18(17)22(24)28/h1-12H |
| InChIKey | VIBWYHAUPHKRIN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|