C18H22N2O2 — CID 171823860
methanamine;2-phenylisoindole-1,3-dione;propane (PubChem CID 171823860) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is methanamine;2-phenylisoindole-1,3-dione;propane.
| Compound Name | methanamine;2-phenylisoindole-1,3-dione;propane |
|---|---|
| PubChem CID | 171823860 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | methanamine;2-phenylisoindole-1,3-dione;propane |
| SMILES | CCC.CN.O=C1c2ccccc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H9NO2.C3H8.CH5N/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10;1-3-2;1-2/h1-9H;3H2,1-2H3;2H2,1H3 |
| InChIKey | RZUDXARRCFPQFW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|