C15H14AsNO5 — CID 162087395
methylarsonic acid;2-phenylisoindole-1,3-dione (PubChem CID 162087395) has the molecular formula C15H14AsNO5 and a molecular weight of 363.20 g/mol. Its IUPAC name is methylarsonic acid;2-phenylisoindole-1,3-dione.
| Compound Name | methylarsonic acid;2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 162087395 |
| Molecular Formula | C15H14AsNO5 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | methylarsonic acid;2-phenylisoindole-1,3-dione |
| SMILES | C[As](=O)(O)O.O=C1c2ccccc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H9NO2.CH5AsO3/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10;1-2(3,4)5/h1-9H;1H3,(H2,3,4,5) |
| InChIKey | ZDDNWZOZJQAQFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|