C20H16N2O2 — CID 168518349
2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]isoindole-1,3-dione (PubChem CID 168518349) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518349 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C)n1-c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H16N2O2/c1-13-7-8-14(2)21(13)15-9-11-16(12-10-15)22-19(23)17-5-3-4-6-18(17)20(22)24/h3-12H,1-2H3 |
| InChIKey | ZQJJUTRDUQUQAK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|