C22H17NO2 — CID 168518344
2-[4-(3,4-dimethylphenyl)phenyl]isoindole-1,3-dione (PubChem CID 168518344) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylphenyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(3,4-dimethylphenyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518344 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[4-(3,4-dimethylphenyl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc1C |
| InChI | InChI=1S/C22H17NO2/c1-14-7-8-17(13-15(14)2)16-9-11-18(12-10-16)23-21(24)19-5-3-4-6-20(19)22(23)25/h3-13H,1-2H3 |
| InChIKey | QVXLEWOEMYTTRF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|