C25H18N2O2S — CID 168518353
2-[3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 168518353) has the molecular formula C25H18N2O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518353 |
| Molecular Formula | C25H18N2O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2csc(-c3cccc(N4C(=O)c5ccccc5C4=O)c3)n2)cc1C |
| InChI | InChI=1S/C25H18N2O2S/c1-15-10-11-17(12-16(15)2)22-14-30-23(26-22)18-6-5-7-19(13-18)27-24(28)20-8-3-4-9-21(20)25(27)29/h3-14H,1-2H3 |
| InChIKey | STWKHMZQRBQBDD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|