C22H17NO2S — CID 169334414
5-[3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]phenyl]furan-2-carbaldehyde (PubChem CID 169334414) has the molecular formula C22H17NO2S and a molecular weight of 359.45 g/mol. Its IUPAC name is 5-[3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334414 |
| Molecular Formula | C22H17NO2S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 5-[3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]phenyl]furan-2-carbaldehyde |
| SMILES | Cc1ccc(-c2csc(-c3cccc(-c4ccc(C=O)o4)c3)n2)cc1C |
| InChI | InChI=1S/C22H17NO2S/c1-14-6-7-16(10-15(14)2)20-13-26-22(23-20)18-5-3-4-17(11-18)21-9-8-19(12-24)25-21/h3-13H,1-2H3 |
| InChIKey | ASCFDFJHQRSWQM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|