C20H17NO3 — CID 169332496
N-(3,4-dimethylphenyl)-3-(5-formylfuran-2-yl)benzamide (PubChem CID 169332496) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-(5-formylfuran-2-yl)benzamide.
| Compound Name | N-(3,4-dimethylphenyl)-3-(5-formylfuran-2-yl)benzamide |
|---|---|
| PubChem CID | 169332496 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-(5-formylfuran-2-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(-c3ccc(C=O)o3)c2)cc1C |
| InChI | InChI=1S/C20H17NO3/c1-13-6-7-17(10-14(13)2)21-20(23)16-5-3-4-15(11-16)19-9-8-18(12-22)24-19/h3-12H,1-2H3,(H,21,23) |
| InChIKey | KNIHQWUEGZINFP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|