C20H24N2O2 — CID 109055998
3-N-tert-butyl-1-N-(3,4-dimethylphenyl)benzene-1,3-dicarboxamide (PubChem CID 109055998) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-N-tert-butyl-1-N-(3,4-dimethylphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-tert-butyl-1-N-(3,4-dimethylphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055998 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-N-tert-butyl-1-N-(3,4-dimethylphenyl)benzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(=O)NC(C)(C)C)c2)cc1C |
| InChI | InChI=1S/C20H24N2O2/c1-13-9-10-17(11-14(13)2)21-18(23)15-7-6-8-16(12-15)19(24)22-20(3,4)5/h6-12H,1-5H3,(H,21,23)(H,22,24) |
| InChIKey | GKHFHRZJHROBJN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |