C19H21IN2O2 — CID 28639414
N-[3-(tert-butylcarbamoyl)phenyl]-3-iodo-4-methylbenzamide (PubChem CID 28639414) has the molecular formula C19H21IN2O2 and a molecular weight of 436.29 g/mol. Its IUPAC name is N-[3-(tert-butylcarbamoyl)phenyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[3-(tert-butylcarbamoyl)phenyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 28639414 |
| Molecular Formula | C19H21IN2O2 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | N-[3-(tert-butylcarbamoyl)phenyl]-3-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(=O)NC(C)(C)C)c2)cc1I |
| InChI | InChI=1S/C19H21IN2O2/c1-12-8-9-14(11-16(12)20)17(23)21-15-7-5-6-13(10-15)18(24)22-19(2,3)4/h5-11H,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | SFBLEQRNFSSKJF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|