C19H22N2O3 — CID 109052570
3-N-(3,4-dimethylphenyl)-1-N-(2-methoxyethyl)benzene-1,3-dicarboxamide (PubChem CID 109052570) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-N-(3,4-dimethylphenyl)-1-N-(2-methoxyethyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(3,4-dimethylphenyl)-1-N-(2-methoxyethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109052570 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-N-(3,4-dimethylphenyl)-1-N-(2-methoxyethyl)benzene-1,3-dicarboxamide |
| SMILES | COCCNC(=O)c1cccc(C(=O)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H22N2O3/c1-13-7-8-17(11-14(13)2)21-19(23)16-6-4-5-15(12-16)18(22)20-9-10-24-3/h4-8,11-12H,9-10H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | XWTLUNQLYIHSCR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|