C20H22N2O5 — CID 109052641
ethyl 4-[[3-(2-methoxyethylcarbamoyl)benzoyl]amino]benzoate (PubChem CID 109052641) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 4-[[3-(2-methoxyethylcarbamoyl)benzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-(2-methoxyethylcarbamoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 109052641 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | ethyl 4-[[3-(2-methoxyethylcarbamoyl)benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cccc(C(=O)NCCOC)c2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-3-27-20(25)14-7-9-17(10-8-14)22-19(24)16-6-4-5-15(13-16)18(23)21-11-12-26-2/h4-10,13H,3,11-12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | RAMQTEXYQJJHRG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|