C25H19ClN2O3 — CID 1344294
N-(3-benzamido-4-methylphenyl)-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 1344294) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is N-(3-benzamido-4-methylphenyl)-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-(3-benzamido-4-methylphenyl)-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1344294 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-(3-benzamido-4-methylphenyl)-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(-c3cccc(Cl)c3)o2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H19ClN2O3/c1-16-10-11-20(15-21(16)28-24(29)17-6-3-2-4-7-17)27-25(30)23-13-12-22(31-23)18-8-5-9-19(26)14-18/h2-15H,1H3,(H,27,30)(H,28,29) |
| InChIKey | PLQDAOYRHPKXEX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |