C26H19N3O3S — CID 60517836
N-(5-benzamido-2-methylphenyl)-5-(1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 60517836) has the molecular formula C26H19N3O3S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-(5-benzamido-2-methylphenyl)-5-(1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(5-benzamido-2-methylphenyl)-5-(1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 60517836 |
| Molecular Formula | C26H19N3O3S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-(5-benzamido-2-methylphenyl)-5-(1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2)cc1NC(=O)c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C26H19N3O3S/c1-16-11-12-18(27-24(30)17-7-3-2-4-8-17)15-20(16)28-25(31)21-13-14-22(32-21)26-29-19-9-5-6-10-23(19)33-26/h2-15H,1H3,(H,27,30)(H,28,31) |
| InChIKey | JMFMYAFCSSZVCF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |