C26H19N3O5S — CID 1349590
N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-5-(2-methoxy-4-nitrophenyl)furan-2-carboxamide (PubChem CID 1349590) has the molecular formula C26H19N3O5S and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-5-(2-methoxy-4-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-5-(2-methoxy-4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1349590 |
| Molecular Formula | C26H19N3O5S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-5-(2-methoxy-4-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C(=O)Nc2cc(-c3nc4ccccc4s3)ccc2C)o1 |
| InChI | InChI=1S/C26H19N3O5S/c1-15-7-8-16(26-28-19-5-3-4-6-24(19)35-26)13-20(15)27-25(30)22-12-11-21(34-22)18-10-9-17(29(31)32)14-23(18)33-2/h3-14H,1-2H3,(H,27,30) |
| InChIKey | PAKCOQZUUMKYSQ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|