C23H18N4O5S2 — CID 22301131
S-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamoylamino] 4-methoxy-3-nitrobenzenecarbothioate (PubChem CID 22301131) has the molecular formula C23H18N4O5S2 and a molecular weight of 494.55 g/mol. Its IUPAC name is S-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamoylamino] 4-methoxy-3-nitrobenzenecarbothioate.
| Compound Name | S-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamoylamino] 4-methoxy-3-nitrobenzenecarbothioate |
|---|---|
| PubChem CID | 22301131 |
| Molecular Formula | C23H18N4O5S2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | S-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamoylamino] 4-methoxy-3-nitrobenzenecarbothioate |
| SMILES | COc1ccc(C(=O)SNC(=O)Nc2cc(-c3nc4ccccc4s3)ccc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18N4O5S2/c1-13-7-8-14(21-24-16-5-3-4-6-20(16)33-21)11-17(13)25-23(29)26-34-22(28)15-9-10-19(32-2)18(12-15)27(30)31/h3-12H,1-2H3,(H2,25,26,29) |
| InChIKey | UBPLXBIQLCFYQW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|