C22H16N4O5S2 — CID 22301136
S-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamoylamino] 4-methoxy-3-nitrobenzenecarbothioate (PubChem CID 22301136) has the molecular formula C22H16N4O5S2 and a molecular weight of 480.53 g/mol. Its IUPAC name is S-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamoylamino] 4-methoxy-3-nitrobenzenecarbothioate.
| Compound Name | S-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamoylamino] 4-methoxy-3-nitrobenzenecarbothioate |
|---|---|
| PubChem CID | 22301136 |
| Molecular Formula | C22H16N4O5S2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | S-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamoylamino] 4-methoxy-3-nitrobenzenecarbothioate |
| SMILES | COc1ccc(C(=O)SNC(=O)Nc2ccc(-c3nc4ccccc4s3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16N4O5S2/c1-31-18-11-8-14(12-17(18)26(29)30)21(27)33-25-22(28)23-15-9-6-13(7-10-15)20-24-16-4-2-3-5-19(16)32-20/h2-12H,1H3,(H2,23,25,28) |
| InChIKey | JTCASYOWKOZAJR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|