C21H14N4O6S — CID 87322286
N-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-3,4-dinitrobenzamide (PubChem CID 87322286) has the molecular formula C21H14N4O6S and a molecular weight of 450.43 g/mol. Its IUPAC name is N-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-3,4-dinitrobenzamide.
| Compound Name | N-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-3,4-dinitrobenzamide |
|---|---|
| PubChem CID | 87322286 |
| Molecular Formula | C21H14N4O6S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-3,4-dinitrobenzamide |
| SMILES | COc1ccc2nc(-c3ccc(NC(=O)c4ccc([N+](=O)[O-])c([N+](=O)[O-])c4)cc3)sc2c1 |
| InChI | InChI=1S/C21H14N4O6S/c1-31-15-7-8-16-19(11-15)32-21(23-16)12-2-5-14(6-3-12)22-20(26)13-4-9-17(24(27)28)18(10-13)25(29)30/h2-11H,1H3,(H,22,26) |
| InChIKey | NUWMMNSSBANRNI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|