C25H21F3N4O4S — CID 58342104
N-[4-[6-[2-(dimethylamino)ethoxy]-1,3-benzothiazol-2-yl]phenyl]-4-nitro-3-(trifluoromethyl)benzamide (PubChem CID 58342104) has the molecular formula C25H21F3N4O4S and a molecular weight of 530.53 g/mol. Its IUPAC name is N-[4-[6-[2-(dimethylamino)ethoxy]-1,3-benzothiazol-2-yl]phenyl]-4-nitro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[6-[2-(dimethylamino)ethoxy]-1,3-benzothiazol-2-yl]phenyl]-4-nitro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58342104 |
| Molecular Formula | C25H21F3N4O4S |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | N-[4-[6-[2-(dimethylamino)ethoxy]-1,3-benzothiazol-2-yl]phenyl]-4-nitro-3-(trifluoromethyl)benzamide |
| SMILES | CN(C)CCOc1ccc2nc(-c3ccc(NC(=O)c4ccc([N+](=O)[O-])c(C(F)(F)F)c4)cc3)sc2c1 |
| InChI | InChI=1S/C25H21F3N4O4S/c1-31(2)11-12-36-18-8-9-20-22(14-18)37-24(30-20)15-3-6-17(7-4-15)29-23(33)16-5-10-21(32(34)35)19(13-16)25(26,27)28/h3-10,13-14H,11-12H2,1-2H3,(H,29,33) |
| InChIKey | LWJDBPHCGBETCZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|