C21H15N3O5S — CID 67313299
4-hydroxy-N-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-3-nitrobenzamide (PubChem CID 67313299) has the molecular formula C21H15N3O5S and a molecular weight of 421.43 g/mol. Its IUPAC name is 4-hydroxy-N-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-hydroxy-N-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 67313299 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 4-hydroxy-N-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-3-nitrobenzamide |
| SMILES | COc1ccc2nc(-c3ccc(NC(=O)c4ccc(O)c([N+](=O)[O-])c4)cc3)sc2c1 |
| InChI | InChI=1S/C21H15N3O5S/c1-29-15-7-8-16-19(11-15)30-21(23-16)12-2-5-14(6-3-12)22-20(26)13-4-9-18(25)17(10-13)24(27)28/h2-11,25H,1H3,(H,22,26) |
| InChIKey | ODQIQHWZAWZOOH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|