C22H18ClN3O3S — CID 46381141
1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(5-chloro-2,4-dimethoxyphenyl)urea (PubChem CID 46381141) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(5-chloro-2,4-dimethoxyphenyl)urea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(5-chloro-2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 46381141 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(5-chloro-2,4-dimethoxyphenyl)urea |
| SMILES | COc1cc(OC)c(NC(=O)Nc2ccc(-c3nc4ccccc4s3)cc2)cc1Cl |
| InChI | InChI=1S/C22H18ClN3O3S/c1-28-18-12-19(29-2)17(11-15(18)23)26-22(27)24-14-9-7-13(8-10-14)21-25-16-5-3-4-6-20(16)30-21/h3-12H,1-2H3,(H2,24,26,27) |
| InChIKey | CMPQADMZYUAEAT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |