C20H13Cl2N3OS — CID 2738352
1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)urea (PubChem CID 2738352) has the molecular formula C20H13Cl2N3OS and a molecular weight of 414.32 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 2738352 |
| Molecular Formula | C20H13Cl2N3OS |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)cc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl2N3OS/c21-13-7-10-16(15(22)11-13)25-20(26)23-14-8-5-12(6-9-14)19-24-17-3-1-2-4-18(17)27-19/h1-11H,(H2,23,25,26) |
| InChIKey | GEYWRTZLDQTVHK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |