C20H13ClFN3S2 — CID 21008643
1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(3-chloro-4-fluorophenyl)thiourea (PubChem CID 21008643) has the molecular formula C20H13ClFN3S2 and a molecular weight of 413.93 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(3-chloro-4-fluorophenyl)thiourea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(3-chloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 21008643 |
| Molecular Formula | C20H13ClFN3S2 |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(3-chloro-4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2ccc(-c3nc4ccccc4s3)cc2)cc1Cl |
| InChI | InChI=1S/C20H13ClFN3S2/c21-15-11-14(9-10-16(15)22)24-20(26)23-13-7-5-12(6-8-13)19-25-17-3-1-2-4-18(17)27-19/h1-11H,(H2,23,24,26) |
| InChIKey | KZPNBQBIGBGHLV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|