C17H15N3OS2 — CID 885171
N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]propanamide (PubChem CID 885171) has the molecular formula C17H15N3OS2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]propanamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 885171 |
| Molecular Formula | C17H15N3OS2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]propanamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H15N3OS2/c1-2-15(21)20-17(22)18-12-9-7-11(8-10-12)16-19-13-5-3-4-6-14(13)23-16/h3-10H,2H2,1H3,(H2,18,20,21,22) |
| InChIKey | JWCWFMIDUMLHSY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|