C24H17N3O2S2 — CID 2902673
N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 2902673) has the molecular formula C24H17N3O2S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2902673 |
| Molecular Formula | C24H17N3O2S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(=S)Nc2ccc(-c3nc4ccccc4s3)cc2)oc2ccccc12 |
| InChI | InChI=1S/C24H17N3O2S2/c1-14-17-6-2-4-8-19(17)29-21(14)22(28)27-24(30)25-16-12-10-15(11-13-16)23-26-18-7-3-5-9-20(18)31-23/h2-13H,1H3,(H2,25,27,28,30) |
| InChIKey | HHIFAFRWLKOALI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|