C22H17N3OS2 — CID 1344774
N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 1344774) has the molecular formula C22H17N3OS2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 1344774 |
| Molecular Formula | C22H17N3OS2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H17N3OS2/c26-20(14-15-6-2-1-3-7-15)25-22(27)23-17-12-10-16(11-13-17)21-24-18-8-4-5-9-19(18)28-21/h1-13H,14H2,(H2,23,25,26,27) |
| InChIKey | XNSQGUWRNLTJRU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|