C23H17N3OS2 — CID 71825386
N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 71825386) has the molecular formula C23H17N3OS2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71825386 |
| Molecular Formula | C23H17N3OS2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NC(=S)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H17N3OS2/c27-21(15-10-16-6-2-1-3-7-16)26-23(28)24-18-13-11-17(12-14-18)22-25-19-8-4-5-9-20(19)29-22/h1-15H,(H2,24,26,27,28) |
| InChIKey | XLOIKANLGFSFMP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|