C24H19N3OS2 — CID 54859151
(E)-N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 54859151) has the molecular formula C24H19N3OS2 and a molecular weight of 429.57 g/mol. Its IUPAC name is (E)-N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 54859151 |
| Molecular Formula | C24H19N3OS2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (E)-N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)Nc1ccc(Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C24H19N3OS2/c28-22(15-12-17-6-2-1-3-7-17)27-24(29)25-19-13-10-18(11-14-19)16-23-26-20-8-4-5-9-21(20)30-23/h1-15H,16H2,(H2,25,27,28,29)/b15-12+ |
| InChIKey | SKHIDDNTXLXZFG-NTCAYCPXSA-N |
| XLogP | 5.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|