C26H24N2OS — CID 54858919
(E)-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 54858919) has the molecular formula C26H24N2OS and a molecular weight of 412.56 g/mol. Its IUPAC name is (E)-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54858919 |
| Molecular Formula | C26H24N2OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (E)-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)Nc2ccc(Cc3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C26H24N2OS/c1-18(2)21-12-7-19(8-13-21)11-16-25(29)27-22-14-9-20(10-15-22)17-26-28-23-5-3-4-6-24(23)30-26/h3-16,18H,17H2,1-2H3,(H,27,29)/b16-11+ |
| InChIKey | BGOCYSOCYAOQLR-LFIBNONCSA-N |
| XLogP | 6.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|