C22H15FN2OS — CID 6139011
(E)-N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 6139011) has the molecular formula C22H15FN2OS and a molecular weight of 374.44 g/mol. Its IUPAC name is (E)-N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6139011 |
| Molecular Formula | C22H15FN2OS |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (E)-N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H15FN2OS/c23-17-10-5-15(6-11-17)7-14-21(26)24-18-12-8-16(9-13-18)22-25-19-3-1-2-4-20(19)27-22/h1-14H,(H,24,26)/b14-7+ |
| InChIKey | RSOBQUHZVSXIBK-VGOFMYFVSA-N |
| XLogP | 5.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|