C20H14N2O2S — CID 876030
N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 876030) has the molecular formula C20H14N2O2S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 876030 |
| Molecular Formula | C20H14N2O2S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H14N2O2S/c23-19(12-11-16-4-3-13-24-16)21-15-9-7-14(8-10-15)20-22-17-5-1-2-6-18(17)25-20/h1-13H,(H,21,23) |
| InChIKey | AYDRFBJNWOSGEV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|