C20H13NO3S — CID 7718933
[2-(1,3-benzothiazol-2-yl)phenyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 7718933) has the molecular formula C20H13NO3S and a molecular weight of 347.40 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)phenyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(1,3-benzothiazol-2-yl)phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7718933 |
| Molecular Formula | C20H13NO3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccco1)Oc1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H13NO3S/c22-19(12-11-14-6-5-13-23-14)24-17-9-3-1-7-15(17)20-21-16-8-2-4-10-18(16)25-20/h1-13H/b12-11+ |
| InChIKey | UGHZMDPZSUGPIG-VAWYXSNFSA-N |
| XLogP | 5.18 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|