C18H13NO4S — CID 8897195
[2-(1,3-benzothiazol-2-yl)phenyl] 2,3-dihydro-1,4-dioxine-5-carboxylate (PubChem CID 8897195) has the molecular formula C18H13NO4S and a molecular weight of 339.37 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)phenyl] 2,3-dihydro-1,4-dioxine-5-carboxylate.
| Compound Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
|---|---|
| PubChem CID | 8897195 |
| Molecular Formula | C18H13NO4S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
| SMILES | O=C(Oc1ccccc1-c1nc2ccccc2s1)C1=COCCO1 |
| InChI | InChI=1S/C18H13NO4S/c20-18(15-11-21-9-10-22-15)23-14-7-3-1-5-12(14)17-19-13-6-2-4-8-16(13)24-17/h1-8,11H,9-10H2 |
| InChIKey | ZPEANLZJQBSARR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|