C22H15NO4S — CID 7936360
[2-(1,3-benzothiazol-2-yl)phenyl] (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 7936360) has the molecular formula C22H15NO4S and a molecular weight of 389.43 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)phenyl] (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | [2-(1,3-benzothiazol-2-yl)phenyl] (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 7936360 |
| Molecular Formula | C22H15NO4S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)phenyl] (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | O=C(Oc1ccccc1-c1nc2ccccc2s1)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C22H15NO4S/c24-22(19-13-25-17-10-4-5-11-18(17)26-19)27-16-9-3-1-7-14(16)21-23-15-8-2-6-12-20(15)28-21/h1-12,19H,13H2/t19-/m1/s1 |
| InChIKey | AUCSSGONOVHEMY-LJQANCHMSA-N |
| XLogP | 4.71 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|