C19H19NO2S — CID 58291241
[2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate (PubChem CID 58291241) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate.
| Compound Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58291241 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H19NO2S/c1-4-19(2,3)18(21)22-15-11-7-5-9-13(15)17-20-14-10-6-8-12-16(14)23-17/h5-12H,4H2,1-3H3 |
| InChIKey | KKUINNMCFINFFB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|