C19H13N3O3S2 — CID 75404025
[2-(1,3-benzothiazol-2-yl)phenyl] 2-acetamido-1,3-thiazole-4-carboxylate (PubChem CID 75404025) has the molecular formula C19H13N3O3S2 and a molecular weight of 395.47 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)phenyl] 2-acetamido-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2-acetamido-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 75404025 |
| Molecular Formula | C19H13N3O3S2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2-acetamido-1,3-thiazole-4-carboxylate |
| SMILES | CC(=O)Nc1nc(C(=O)Oc2ccccc2-c2nc3ccccc3s2)cs1 |
| InChI | InChI=1S/C19H13N3O3S2/c1-11(23)20-19-22-14(10-26-19)18(24)25-15-8-4-2-6-12(15)17-21-13-7-3-5-9-16(13)27-17/h2-10H,1H3,(H,20,22,23) |
| InChIKey | UVIARDNPPQZOAM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|