C21H16N2O3S — CID 7936346
[2-(1,3-benzothiazol-2-yl)phenyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 7936346) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)phenyl] 2-ethoxypyridine-3-carboxylate.
| Compound Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 7936346 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)Oc1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H16N2O3S/c1-2-25-19-15(9-7-13-22-19)21(24)26-17-11-5-3-8-14(17)20-23-16-10-4-6-12-18(16)27-20/h3-13H,2H2,1H3 |
| InChIKey | WNDSADVHPYGWFO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|