C20H20N2O3S — CID 2581527
[2-(diethylamino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate (PubChem CID 2581527) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 2581527 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
| SMILES | CCN(CC)C(=O)COC(=O)c1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H20N2O3S/c1-3-22(4-2)18(23)13-25-20(24)15-10-6-5-9-14(15)19-21-16-11-7-8-12-17(16)26-19/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | MXAOJTYJMUIWCJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |